|
CAS#: 85232-76-4 Product: 2-Methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-1-penten-3-ol No suppilers available for the product. |
| Name | 2-Methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-1-penten-3-ol |
|---|---|
| Synonyms | 1-Penten- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32 |
| CAS Registry Number | 85232-76-4 |
| EINECS | 286-397-3 |
| SMILES | CCC(O)C(C)=CC2CC1/C=C\C2(C)C1 |
| InChI | 1S/C14H22O/c1-4-13(15)10(2)7-12-8-11-5-6-14(12,3)9-11/h5-7,11-13,15H,4,8-9H2,1-3H3 |
| InChIKey | HBRAQFPKBXTVBT-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.774°C at 760 mmHg (Cal.) |
| Flash point | 111.726°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-1-penten-3-ol |