|
CAS#: 85237-58-7 Product: N-[4-Amino-3-[(P-Tolyl)Sulphonyl]Phenyl]Benzamide No suppilers available for the product. |
| Name | N-[4-Amino-3-[(P-Tolyl)Sulphonyl]Phenyl]Benzamide |
|---|---|
| Synonyms | N-[4-Amino-3-(4-Methylphenyl)Sulfonyl-Phenyl]Benzamide; N-(4-Amino-3-((P-Tolyl)Sulphonyl)Phenyl)Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.43 |
| CAS Registry Number | 85237-58-7 |
| EINECS | 286-418-6 |
| SMILES | C2=C(NC(=O)C1=CC=CC=C1)C=CC(=C2[S](=O)(=O)C3=CC=C(C=C3)C)N |
| InChI | 1S/C20H18N2O3S/c1-14-7-10-17(11-8-14)26(24,25)19-13-16(9-12-18(19)21)22-20(23)15-5-3-2-4-6-15/h2-13H,21H2,1H3,(H,22,23) |
| InChIKey | WEXAOBVLOYDCGA-UHFFFAOYSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 519.806°C at 760 mmHg (Cal.) |
| Flash point | 268.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-Amino-3-[(P-Tolyl)Sulphonyl]Phenyl]Benzamide |