|
CAS#: 852527-41-4 Product: 1-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl)-1H-pyrrole-2,5-dione No suppilers available for the product. |
| Name | 1-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl)-1H-pyrrole-2,5-dione |
|---|---|
| Synonyms | N-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl)maleimide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8F13NO2 |
| Molecular Weight | 457.19 |
| CAS Registry Number | 852527-41-4 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCN1C(=O)\C=C/C1=O |
| InChI | 1S/C13H8F13NO2/c14-8(15,4-1-5-27-6(28)2-3-7(27)29)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h2-3H,1,4-5H2 |
| InChIKey | XCBJTYHAGWXMIM-UHFFFAOYSA-N |
| Density | 1.575g/cm3 (Cal.) |
|---|---|
| Boiling point | 289.821°C at 760 mmHg (Cal.) |
| Flash point | 129.079°C (Cal.) |
| Refractive index | 1.369 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4,4,5,5,6,6,7,7,8,8,9,9,9-Tridecafluorononyl)-1H-pyrrole-2,5-dione |