|
CAS#: 85278-66-6 Product: 2-(3,4-Dimethoxyphenyl)-3-Fluoroallylamine No suppilers available for the product. |
| Name | 2-(3,4-Dimethoxyphenyl)-3-Fluoroallylamine |
|---|---|
| Synonyms | (E)-2-(3,4-Dimethoxyphenyl)-3-Fluoro-Prop-2-En-1-Amine; [(E)-2-(3,4-Dimethoxyphenyl)-3-Fluoro-Prop-2-Enyl]Amine; 2-(3,4-Dimethoxyphenyl)-3-Fluoroallylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 |
| CAS Registry Number | 85278-66-6 |
| SMILES | C1=C(C(=CC=C1C(=C\F)/CN)OC)OC |
| InChI | 1S/C11H14FNO2/c1-14-10-4-3-8(5-11(10)15-2)9(6-12)7-13/h3-6H,7,13H2,1-2H3/b9-6- |
| InChIKey | HLNSVKSSCLHOSW-TWGQIWQCSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.532°C at 760 mmHg (Cal.) |
| Flash point | 158.539°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dimethoxyphenyl)-3-Fluoroallylamine |