Online Database of Chemicals from Around the World
|
CAS#: 85283-85-8 Product: 1-Amino-4-({4-[2-(diethylamino)ethoxy]phenyl}amino)-9,10-anthraquinone acetate (1:1) No suppilers available for the product. |
| Name | 1-Amino-4-({4-[2-(diethylamino)ethoxy]phenyl}amino)-9,10-anthraquinone acetate (1:1) |
|---|---|
| Synonyms | 1-amino-4 |
| Molecular Structure | ![CAS#: 85283-85-8, 1-Amino-4-({4-[2-(diethylamino)ethoxy]phenyl}amino)-9,10-anthraquinone acetate (1:1)](/moreStructures/85283-85-8.gif) |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.56 |
| CAS Registry Number | 85283-85-8 |
| EINECS | 286-613-6 |
| SMILES | CC(O)=O.CCN(CC)CCOc1ccc(cc1)Nc4ccc(N)c3C(=O)c2ccccc2C(=O)c34 |
| InChI | 1S/C26H27N3O3.C2H4O2/c1-3-29(4-2)15-16-32-18-11-9-17(10-12-18)28-22-14-13-21(27)23-24(22)26(31)20-8-6-5-7-19(20)25(23)30;1-2(3)4/h5-14,28H,3-4,15-16,27H2,1-2H3;1H3,(H,3,4) |
| InChIKey | WJWVABVSKCSYRS-UHFFFAOYSA-N |
| Boiling point | 715.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 386.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-4-({4-[2-(diethylamino)ethoxy]phenyl}amino)-9,10-anthraquinone acetate (1:1) |