|
CAS#: 85318-25-8 Product: Riccardin A No suppilers available for the product. |
| Name | Riccardin A |
|---|---|
| Synonyms | Riccardin A |
| Molecular Structure | ![]() |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 |
| CAS Registry Number | 85318-25-8 |
| SMILES | C4=C3C1C(=CC(C=C1)\C=C/C2=CC=C(O)C(=C2)OC5C=CC(\C=C/C3=CC(=C4)OC)C=C5)O |
| InChI | 1S/C29H26O4/c1-32-24-12-14-25-22(18-24)9-4-19-5-10-23(11-6-19)33-29-17-21(8-15-27(29)30)3-2-20-7-13-26(25)28(31)16-20/h2-20,23,26,30-31H,1H3/b3-2-,9-4- |
| InChIKey | DWNRPHOAQFBQKK-UARZHTBLSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 674.406°C at 760 mmHg (Cal.) |
| Flash point | 361.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Riccardin A |