|
CAS#: 85382-36-1 Product: 4,5-Epoxyestrene-3-One-17-Ol No suppilers available for the product. |
| Name | 4,5-Epoxyestrene-3-One-17-Ol |
|---|---|
| Synonyms | 4,5-Epoxyestrene-3-One-17-Ol; Estr-1-En-3-One, 4,5-Epoxy-17-Hydroxy-, (4Beta,5Beta,17Beta)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 |
| CAS Registry Number | 85382-36-1 |
| SMILES | [C@@H]15C(C=C[C@H]3[C@@]1(CC[C@H]4[C@@H]2CC[C@@H]([C@@]2(C)CC[C@H]34)O)O5)=O |
| InChI | 1S/C18H24O3/c1-17-8-6-11-10(12(17)3-5-15(17)20)7-9-18-13(11)2-4-14(19)16(18)21-18/h2,4,10-13,15-16,20H,3,5-9H2,1H3/t10-,11+,12+,13-,15+,16-,17+,18-/m1/s1 |
| InChIKey | OVRPQVINUMQNMU-SVIAEIDWSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 167.5±22.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Epoxyestrene-3-One-17-Ol |