|
CAS#: 85391-67-9 Product: 4-Chloro-2-(3,4-Dichlorophenoxy)Benzothiazole No suppilers available for the product. |
| Name | 4-Chloro-2-(3,4-Dichlorophenoxy)Benzothiazole |
|---|---|
| Synonyms | 4-Chloro-2-(3,4-Dichlorophenoxy)Benzothiazole; Nsc209901 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H6Cl3NOS |
| Molecular Weight | 330.62 |
| CAS Registry Number | 85391-67-9 |
| EINECS | 286-823-8 |
| SMILES | C3=C(OC1=NC2=C(S1)C=CC=C2Cl)C=CC(=C3Cl)Cl |
| InChI | 1S/C13H6Cl3NOS/c14-8-5-4-7(6-10(8)16)18-13-17-12-9(15)2-1-3-11(12)19-13/h1-6H |
| InChIKey | WVZBHTIDWMGRPP-UHFFFAOYSA-N |
| Density | 1.554g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.578°C at 760 mmHg (Cal.) |
| Flash point | 225.697°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-(3,4-Dichlorophenoxy)Benzothiazole |