|
CAS#: 85391-89-5 Product: 4-Hydroxy-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one No suppilers available for the product. |
| Name | 4-Hydroxy-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one |
|---|---|
| Synonyms | (1R-(1α,4 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.23 |
| CAS Registry Number | 85391-89-5 |
| EINECS | 286-845-8 |
| SMILES | O=C1C(O)(CC2C(C1)C2(C)C)C |
| InChI | 1S/C10H16O2/c1-9(2)6-4-8(11)10(3,12)5-7(6)9/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | ZPUQSQULULBFIN-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.077°C at 760 mmHg (Cal.) |
| Flash point | 104.457°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxy-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one |