|
CAS#: 85392-43-4 Product: 3-[2-(2,2,3-Trimethylcyclopent-3-En-1-Yl)Ethylidene]Pentane-2,4-Dione No suppilers available for the product. |
| Name | 3-[2-(2,2,3-Trimethylcyclopent-3-En-1-Yl)Ethylidene]Pentane-2,4-Dione |
|---|---|
| Synonyms | 3-(2-(2,2,3-Trimethylcyclopent-3-En-1-Yl)Ethylidene)Pentane-2,4-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| CAS Registry Number | 85392-43-4 |
| EINECS | 286-902-7 |
| SMILES | C(C1C(C(=CC1)C)(C)C)C=C(C(=O)C)C(=O)C |
| InChI | 1S/C15H22O2/c1-10-6-7-13(15(10,4)5)8-9-14(11(2)16)12(3)17/h6,9,13H,7-8H2,1-5H3 |
| InChIKey | OKUGEEUWTIUDSY-UHFFFAOYSA-N |
| Density | 0.952g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.225°C at 760 mmHg (Cal.) |
| Flash point | 136.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[2-(2,2,3-Trimethylcyclopent-3-En-1-Yl)Ethylidene]Pentane-2,4-Dione |