|
CAS#: 85422-97-5 Product: Bis[2-(acryloyloxy)-N,N-dimethylethanaminium] sulfate No suppilers available for the product. |
| Name | Bis[2-(acryloyloxy)-N,N-dimethylethanaminium] sulfate |
|---|---|
| Synonyms | bis[[2-(acryloyloxy)ethyl]dimethylammonium] sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H28N2O8S |
| Molecular Weight | 384.45 |
| CAS Registry Number | 85422-97-5 |
| EINECS | 287-198-4 |
| SMILES | O=C(OCC[NH+](C)C)C=C.[O-]S([O-])(=O)=O.C[NH+](C)CCOC(=O)C=C |
| InChI | 1S/2C7H13NO2.H2O4S/c2*1-4-7(9)10-6-5-8(2)3;1-5(2,3)4/h2*4H,1,5-6H2,2-3H3;(H2,1,2,3,4) |
| InChIKey | RJOJHQGGFNGFEI-UHFFFAOYSA-N |
| Boiling point | 508.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 261.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis[2-(acryloyloxy)-N,N-dimethylethanaminium] sulfate |