|
CAS#: 85437-82-7 Product: N-((Bis(Dimethylamino)Phosphinyl)Oxy)-N-Methyl-Methanamine No suppilers available for the product. |
| Name | N-((Bis(Dimethylamino)Phosphinyl)Oxy)-N-Methyl-Methanamine |
|---|---|
| Synonyms | N-Bis(Dimethylamino)Phosphoryloxy-N-Methyl-Methanamine; (Dimethylamino-Dimethylaminooxy-Phosphoryl)-Dimethyl-Amine; Methanamine, N-((Bis(Dimethylamino)Phosphinyl)Oxy)-N-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H18N3O2P |
| Molecular Weight | 195.20 |
| CAS Registry Number | 85437-82-7 |
| SMILES | CN(C)O[P](=O)(N(C)C)N(C)C |
| InChI | 1S/C6H18N3O2P/c1-7(2)11-12(10,8(3)4)9(5)6/h1-6H3 |
| InChIKey | DSUPKHVGSRFUCE-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 212.454°C at 760 mmHg (Cal.) |
| Flash point | 82.29°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-((Bis(Dimethylamino)Phosphinyl)Oxy)-N-Methyl-Methanamine |