|
CAS#: 85455-51-2 Product: 2-{Cyclohexyl[4-(2,2-dicyanovinyl)-3-methylphenyl]amino}ethyl phenylcarbamate No suppilers available for the product. |
| Name | 2-{Cyclohexyl[4-(2,2-dicyanovinyl)-3-methylphenyl]amino}ethyl phenylcarbamate |
|---|---|
| Synonyms | 2-[N-cycl |
| Molecular Structure | ![]() |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.53 |
| CAS Registry Number | 85455-51-2 |
| EINECS | 287-287-8 |
| SMILES | N#CC(C#N)=Cc1ccc(cc1C)N(CCOC(=O)Nc2ccccc2)C3CCCCC3 |
| InChI | 1S/C26H28N4O2/c1-20-16-25(13-12-22(20)17-21(18-27)19-28)30(24-10-6-3-7-11-24)14-15-32-26(31)29-23-8-4-2-5-9-23/h2,4-5,8-9,12-13,16-17,24H,3,6-7,10-11,14-15H2,1H3,(H,29,31) |
| InChIKey | WEIWQJRQSLNRJV-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 603.084°C at 760 mmHg (Cal.) |
| Flash point | 318.534°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-{Cyclohexyl[4-(2,2-dicyanovinyl)-3-methylphenyl]amino}ethyl phenylcarbamate |