|
CAS#: 85455-66-9 Product: 2-Thienylmethyl Benzoate No suppilers available for the product. |
| Name | 2-Thienylmethyl Benzoate |
|---|---|
| Synonyms | 2-Thienylmethyl Benzoate; Benzoic Acid 2-Thienylmethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.27 |
| CAS Registry Number | 85455-66-9 |
| EINECS | 287-300-7 |
| SMILES | C1=CC=C(S1)COC(=O)C2=CC=CC=C2 |
| InChI | 1S/C12H10O2S/c13-12(10-5-2-1-3-6-10)14-9-11-7-4-8-15-11/h1-8H,9H2 |
| InChIKey | QFKZQXHPVSHDMJ-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.709°C at 760 mmHg (Cal.) |
| Flash point | 151.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Thienylmethyl Benzoate |