|
CAS#: 85482-86-6 Product: 1-Butyryl-4-hydroxy-L-proline No suppilers available for the product. |
| Name | 1-Butyryl-4-hydroxy-L-proline |
|---|---|
| Synonyms | trans-4-hydroxy-1-(1-oxobutyl)-L-proline |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 |
| CAS Registry Number | 85482-86-6 |
| EINECS | 287-377-7 |
| SMILES | OC1C[C@@H](C(O)=O)N(C1)C(=O)CCC |
| InChI | 1S/C9H15NO4/c1-2-3-8(12)10-5-6(11)4-7(10)9(13)14/h6-7,11H,2-5H2,1H3,(H,13,14)/t6?,7-/m0/s1 |
| InChIKey | POHGHGLKBPAVNJ-MLWJPKLSSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.95°C at 760 mmHg (Cal.) |
| Flash point | 221.084°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Butyryl-4-hydroxy-L-proline |