|
CAS#: 85508-32-3 Product: Methyl 11H-dibenzo[b,e][1,4]dioxepin-11-ylideneacetate No suppilers available for the product. |
| Name | Methyl 11H-dibenzo[b,e][1,4]dioxepin-11-ylideneacetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.26 |
| CAS Registry Number | 85508-32-3 |
| EINECS | 287-458-7 |
| SMILES | COC(=O)C=C2Oc3ccccc3Oc1ccccc12 |
| InChI | 1S/C16H12O4/c1-18-16(17)10-15-11-6-2-3-7-12(11)19-13-8-4-5-9-14(13)20-15/h2-10H,1H3 |
| InChIKey | NAIDLBXXPCUDGF-UHFFFAOYSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.984°C at 760 mmHg (Cal.) |
| Flash point | 182.859°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 11H-dibenzo[b,e][1,4]dioxepin-11-ylideneacetate |