|
CAS#: 85508-35-6 Product: 2-Chloro-5-(Phenylsulphonyl)Aniline No suppilers available for the product. |
| Name | 2-Chloro-5-(Phenylsulphonyl)Aniline |
|---|---|
| Synonyms | 2-Chloro-5-Phenylsulfonyl-Aniline; (2-Chloro-5-Phenylsulfonyl-Phenyl)Amine; 2-Chloro-5-(Phenylsulphonyl)Aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.73 |
| CAS Registry Number | 85508-35-6 |
| EINECS | 287-460-8 |
| SMILES | C2=C([S](C1=CC=CC=C1)(=O)=O)C=CC(=C2N)Cl |
| InChI | 1S/C12H10ClNO2S/c13-11-7-6-10(8-12(11)14)17(15,16)9-4-2-1-3-5-9/h1-8H,14H2 |
| InChIKey | PNYNNXFKKSRJJS-UHFFFAOYSA-N |
| Density | 1.394g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.617°C at 760 mmHg (Cal.) |
| Flash point | 233.583°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-5-(Phenylsulphonyl)Aniline |