|
CAS#: 85536-82-9 Product: Ethyl 3-(6-methoxy-2-naphthyl)-2,2-dimethyl-3-pentenoate No suppilers available for the product. |
| Name | Ethyl 3-(6-methoxy-2-naphthyl)-2,2-dimethyl-3-pentenoate |
|---|---|
| Synonyms | ethyl β-e |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40 |
| CAS Registry Number | 85536-82-9 |
| EINECS | 287-569-0 |
| SMILES | CCOC(=O)C(C)(C)C(=CC)c1ccc2cc(ccc2c1)OC |
| InChI | 1S/C20H24O3/c1-6-18(20(3,4)19(21)23-7-2)16-9-8-15-13-17(22-5)11-10-14(15)12-16/h6,8-13H,7H2,1-5H3 |
| InChIKey | OUGQIXURPUYNAB-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.706°C at 760 mmHg (Cal.) |
| Flash point | 186.947°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(6-methoxy-2-naphthyl)-2,2-dimethyl-3-pentenoate |