|
CAS#: 85536-83-0 Product: 2-Chloro-alpha-(Nitromethyl)Benzyl Alcohol No suppilers available for the product. |
| Name | 2-Chloro-alpha-(Nitromethyl)Benzyl Alcohol |
|---|---|
| Synonyms | 1-(2-Chlorophenyl)-2-Nitro-Ethanol; Nsc3940 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 |
| CAS Registry Number | 85536-83-0 |
| EINECS | 287-570-6 |
| SMILES | C1=C(C(O)C[N+]([O-])=O)C(=CC=C1)Cl |
| InChI | 1S/C8H8ClNO3/c9-7-4-2-1-3-6(7)8(11)5-10(12)13/h1-4,8,11H,5H2 |
| InChIKey | NSILZMQANUEUBT-UHFFFAOYSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.903°C at 760 mmHg (Cal.) |
| Flash point | 162.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-alpha-(Nitromethyl)Benzyl Alcohol |