|
CAS#: 85561-27-9 Product: Technetium Tc 99M N-Phosphorylaminoethyl Phosphate No suppilers available for the product. |
| Name | Technetium Tc 99M N-Phosphorylaminoethyl Phosphate |
|---|---|
| Synonyms | Phosphoramidic Acid, (2-(Phosphonooxy)Ethyl)-, Technetium-99Tc Salt; Tc-99M-Paep; Technetium Tc 99M N-Phosphorylaminoethyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C2H9NO7P2Tc |
| Molecular Weight | 319.95 |
| CAS Registry Number | 85561-27-9 |
| SMILES | [99Tc].C(O[P](=O)(O)O)CN[P](=O)(O)O |
| InChI | 1S/C2H9NO7P2.Tc/c4-11(5,6)3-1-2-10-12(7,8)9;/h1-2H2,(H2,7,8,9)(H3,3,4,5,6);/i;1+1 |
| InChIKey | BYAYRWRLMYXJHR-IEOVAKBOSA-N |
| Boiling point | 560.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 292.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Technetium Tc 99M N-Phosphorylaminoethyl Phosphate |