|
CAS#: 855634-10-5 Product: 3,7-Dichloro-4-hydroxy-2-quinolinecarboxylic acid No suppilers available for the product. |
| Name | 3,7-Dichloro-4-hydroxy-2-quinolinecarboxylic acid |
|---|---|
| Synonyms | 2-Quinolinecarboxylic acid, 3,7-dichloro-4-hydroxy-; 2-QUINOLINECARBOXYLICACID, 3,7-DICHLORO-4-HYDROXY-; 3,7-Dichlor-4-hydroxy-2-chinolincarbonsäure |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl2NO3 |
| Molecular Weight | 258.06 |
| CAS Registry Number | 855634-10-5 |
| SMILES | c1cc2c(cc1Cl)nc(c(c2O)Cl)C(=O)O |
| InChI | 1S/C10H5Cl2NO3/c11-4-1-2-5-6(3-4)13-8(10(15)16)7(12)9(5)14/h1-3H,(H,13,14)(H,15,16) |
| InChIKey | RWXNRQCCUAVISL-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 208.1±28.7°C (Cal.) |
| Refractive index | 1.734 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dichloro-4-hydroxy-2-quinolinecarboxylic acid |