|
CAS#: 85586-66-9 Product: (1S,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl 2-methylpropanoate No suppilers available for the product. |
| Name | (1S,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl 2-methylpropanoate |
|---|---|
| Synonyms | endo-(-)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl isobutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 |
| CAS Registry Number | 85586-66-9 |
| EINECS | 287-871-2 |
| SMILES | O=C(O[C@@H]1C[C@@H]2CC[C@@]1(C)C2(C)C)C(C)C |
| InChI | 1S/C14H24O2/c1-9(2)12(15)16-11-8-10-6-7-14(11,5)13(10,3)4/h9-11H,6-8H2,1-5H3/t10-,11+,14+/m0/s1 |
| InChIKey | KRKIAJBQOUBNSE-MISXGVKJSA-N |
| Density | 0.984g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.993°C at 760 mmHg (Cal.) |
| Flash point | 105.726°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2R,4S)-1,7,7-Trimethylbicyclo[2.2.1]hept-2-yl 2-methylpropanoate |