|
CAS#: 85614-48-8 Product: Isopropyl cyclohexyl(3-thienyl)acetate No suppilers available for the product. |
| Name | Isopropyl cyclohexyl(3-thienyl)acetate |
|---|---|
| Synonyms | isopropyl α-cyclohexylthiophen-3-acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.40 |
| CAS Registry Number | 85614-48-8 |
| EINECS | 287-934-4 |
| SMILES | CC(C)OC(=O)C(C1CCCCC1)c2ccsc2 |
| InChI | 1S/C15H22O2S/c1-11(2)17-15(16)14(13-8-9-18-10-13)12-6-4-3-5-7-12/h8-12,14H,3-7H2,1-2H3 |
| InChIKey | NXLPGUAUJVEXTR-UHFFFAOYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.173°C at 760 mmHg (Cal.) |
| Flash point | 167.393°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl cyclohexyl(3-thienyl)acetate |