|
CAS#: 85628-24-6 Product: 1-Nitro-2-pyrenol No suppilers available for the product. |
| Name | 1-Nitro-2-pyrenol |
|---|---|
| Synonyms | 1-nitropyrene-2-ol; BRN 5565084 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.25 |
| CAS Registry Number | 85628-24-6 |
| SMILES | [O-][N+](=O)c3c2ccc1cccc4c1c2c(cc3O)cc4 |
| InChI | 1S/C16H9NO3/c18-13-8-11-5-4-9-2-1-3-10-6-7-12(15(11)14(9)10)16(13)17(19)20/h1-8,18H |
| InChIKey | ATOIPTUNDVJRLM-UHFFFAOYSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.637°C at 760 mmHg (Cal.) |
| Flash point | 196.174°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-2-pyrenol |