Online Database of Chemicals from Around the World
|
CAS#: 85650-95-9 Product: Methyl 2-{[(2,3-dimethyl-1-cyclohexen-1-yl)methylene]amino}benzoate No suppilers available for the product. |
| Name | Methyl 2-{[(2,3-dimethyl-1-cyclohexen-1-yl)methylene]amino}benzoate |
|---|---|
| Synonyms | methyl 2-[[(dimethylcyclohexenyl)methylene]amino]benzoate |
| Molecular Structure | ![CAS#: 85650-95-9, Methyl 2-{[(2,3-dimethyl-1-cyclohexen-1-yl)methylene]amino}benzoate](/moreStructures/85650-95-9.gif) |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.35 |
| CAS Registry Number | 85650-95-9 |
| EINECS | 288-106-5 |
| SMILES | CC=2C(C)CCCC=2C=Nc1ccccc1C(=O)OC |
| InChI | 1S/C17H21NO2/c1-12-7-6-8-14(13(12)2)11-18-16-10-5-4-9-15(16)17(19)20-3/h4-5,9-12H,6-8H2,1-3H3 |
| InChIKey | WQTAUSMJLGVFOU-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 409°C at 760 mmHg (Cal.) |
| Flash point | 167.975°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-{[(2,3-dimethyl-1-cyclohexen-1-yl)methylene]amino}benzoate |