Online Database of Chemicals from Around the World
|
CAS#: 856678-57-4 Product: 7-Iodo-2,3-dihydro-1-benzofuran-5-sulfonyl chloride No suppilers available for the product. |
| Name | 7-Iodo-2,3-dihydro-1-benzofuran-5-sulfonyl chloride |
|---|---|
| Synonyms | 5-BENZOFURANSULFONYLCHLORIDE, 2,3-DIHYDRO-7-IODO-; 7-Iodo-2,3-dihydro-benzofuran-5-sulfonyl chloride; 7-IODO-2,3-DIHYDROBENZOFURAN-5-SULFONYLCHLORIDE |
| Molecular Structure |  |
| Molecular Formula | C8H6ClIO3S |
| Molecular Weight | 344.55 |
| CAS Registry Number | 856678-57-4 |
| SMILES | c1c(cc(c2c1CCO2)I)S(=O)(=O)Cl |
| InChI | 1S/C8H6ClIO3S/c9-14(11,12)6-3-5-1-2-13-8(5)7(10)4-6/h3-4H,1-2H2 |
| InChIKey | DNUUNDQTPJVHBK-UHFFFAOYSA-N |
| Density | 2.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.715°C at 760 mmHg (Cal.) |
| Flash point | 205.822°C (Cal.) |
| Refractive index | 1.662 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Iodo-2,3-dihydro-1-benzofuran-5-sulfonyl chloride |