|
CAS#: 85679-51-2 Product: Methyl 7-{(1R,2R,3R)-3-hydroxy-2-[(1E,3R,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-6-oxoheptanoate No suppilers available for the product. |
| Name | Methyl 7-{(1R,2R,3R)-3-hydroxy-2-[(1E,3R,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-6-oxoheptanoate |
|---|---|
| Synonyms | 17,20-Dimethyl-6-oxo-PGE1 Me ester; 17,20-Dimethyl-6-oxo-prostaglandin E1 methyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.54 |
| CAS Registry Number | 85679-51-2 |
| SMILES | O=C(OC)CCCCC(=O)C[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@H](O)C[C@@H](C)CCCC |
| InChI | 1S/C23H38O6/c1-4-5-8-16(2)13-18(25)11-12-19-20(22(27)15-21(19)26)14-17(24)9-6-7-10-23(28)29-3/h11-12,16,18-21,25-26H,4-10,13-15H2,1-3H3/b12-11+/t16-,18-,19+,20+,21+/m0/s1 |
| InChIKey | BBRBUTFBTUFFBU-VZZCMBKRSA-N |
| Density | 1.112g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.821°C at 760 mmHg (Cal.) |
| Flash point | 178.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 7-{(1R,2R,3R)-3-hydroxy-2-[(1E,3R,5S)-3-hydroxy-5-methyl-1-nonen-1-yl]-5-oxocyclopentyl}-6-oxoheptanoate |