|
CAS#: 85684-40-8 Product: 1,3,5,7-Tetraphenyl-3,7-Dithio-1,5-Diaza-3,7-Diphosphacyclooctane No suppilers available for the product. |
| Name | 1,3,5,7-Tetraphenyl-3,7-Dithio-1,5-Diaza-3,7-Diphosphacyclooctane |
|---|---|
| Synonyms | 1,3,5,7-T |
| Molecular Structure | ![]() |
| Molecular Formula | C28H28N2P2S2 |
| Molecular Weight | 518.61 |
| CAS Registry Number | 85684-40-8 |
| SMILES | S=P5(c1ccccc1)CN(c2ccccc2)CP(=S)(c3ccccc3)CN(c4ccccc4)C5 |
| InChI | 1S/C28H28N2P2S2/c33-31(27-17-9-3-10-18-27)21-29(25-13-5-1-6-14-25)22-32(34,28-19-11-4-12-20-28)24-30(23-31)26-15-7-2-8-16-26/h1-20H,21-24H2 |
| InChIKey | DKZHGUKZHWZGOL-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 687.378°C at 760 mmHg (Cal.) |
| Flash point | 369.513°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5,7-Tetraphenyl-3,7-Dithio-1,5-Diaza-3,7-Diphosphacyclooctane |