|
CAS#: 85702-71-2 Product: 5-Chloro-1-(phenylsulfonyl)-1H-indole-2,3-dione No suppilers available for the product. |
| Name | 5-Chloro-1-(phenylsulfonyl)-1H-indole-2,3-dione |
|---|---|
| Synonyms | 5-chloro-1-(phenylsulphonyl)-1H-indole-2,3-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8ClNO4S |
| Molecular Weight | 321.74 |
| CAS Registry Number | 85702-71-2 |
| EINECS | 288-261-9 |
| SMILES | O=S(=O)(c1ccccc1)N3c2ccc(Cl)cc2C(=O)C3=O |
| InChI | 1S/C14H8ClNO4S/c15-9-6-7-12-11(8-9)13(17)14(18)16(12)21(19,20)10-4-2-1-3-5-10/h1-8H |
| InChIKey | ZWWPMBSAJGGCOH-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.71°C at 760 mmHg (Cal.) |
| Flash point | 274.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-1-(phenylsulfonyl)-1H-indole-2,3-dione |