|
CAS#: 85720-84-9 Product: 2-(4-Tert-Butyl-2-Cyclopentylphenoxy)-1-Methylethyl Chloroformate No suppilers available for the product. |
| Name | 2-(4-Tert-Butyl-2-Cyclopentylphenoxy)-1-Methylethyl Chloroformate |
|---|---|
| Synonyms | 2-(4-tert |
| Molecular Structure | ![]() |
| Molecular Formula | C19H27ClO3 |
| Molecular Weight | 338.87 |
| CAS Registry Number | 85720-84-9 |
| EINECS | 288-391-6 |
| SMILES | ClC(=O)OC(C)COc1ccc(cc1C2CCCC2)C(C)(C)C |
| InChI | 1S/C19H27ClO3/c1-13(23-18(20)21)12-22-17-10-9-15(19(2,3)4)11-16(17)14-7-5-6-8-14/h9-11,13-14H,5-8,12H2,1-4H3 |
| InChIKey | SDTYWAICBVIOKU-UHFFFAOYSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.986°C at 760 mmHg (Cal.) |
| Flash point | 137.953°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Tert-Butyl-2-Cyclopentylphenoxy)-1-Methylethyl Chloroformate |