|
CAS#: 85721-04-6 Product: 6-Fluoro-9-(3-iodopropyl)-2-(trifluoromethyl)-9H-thioxanthene No suppilers available for the product. |
| Name | 6-Fluoro-9-(3-iodopropyl)-2-(trifluoromethyl)-9H-thioxanthene |
|---|---|
| Synonyms | 6-fluoro-2-trifluoromethyl-9-(3-iodopropyl)-9H-thioxanthene |
| Molecular Structure | ![]() |
| Molecular Formula | C17H13F4IS |
| Molecular Weight | 452.25 |
| CAS Registry Number | 85721-04-6 |
| EINECS | 288-413-4 |
| SMILES | FC(F)(F)c3ccc2Sc1c(ccc(F)c1)C(c2c3)CCCI |
| InChI | 1S/C17H13F4IS/c18-11-4-5-13-12(2-1-7-22)14-8-10(17(19,20)21)3-6-15(14)23-16(13)9-11/h3-6,8-9,12H,1-2,7H2 |
| InChIKey | FXKLTDSAOBKIMJ-UHFFFAOYSA-N |
| Density | 1.638g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.758°C at 760 mmHg (Cal.) |
| Flash point | 199.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Fluoro-9-(3-iodopropyl)-2-(trifluoromethyl)-9H-thioxanthene |