Online Database of Chemicals from Around the World
|
CAS#: 85741-21-5 Product: 4-(3-Bromophenyl)-1,3-dihydro-2H-1,5-benzodiazepine-2-thione No suppilers available for the product. |
| Name | 4-(3-Bromophenyl)-1,3-dihydro-2H-1,5-benzodiazepine-2-thione |
|---|---|
| Synonyms | 4-(3-bromophenyl)-1,3-dihydro-2H-1,5-benzodiazepin-2-thione; 4-Bdbdt |
| Molecular Structure |  |
| Molecular Formula | C15H11BrN2S |
| Molecular Weight | 331.23 |
| CAS Registry Number | 85741-21-5 |
| SMILES | Brc3cccc(\C2=N\c1ccccc1NC(=S)C2)c3 |
| InChI | 1S/C15H11BrN2S/c16-11-5-3-4-10(8-11)14-9-15(19)18-13-7-2-1-6-12(13)17-14/h1-8H,9H2,(H,18,19) |
| InChIKey | WKLCRCKTSIBQSL-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.661°C at 760 mmHg (Cal.) |
| Flash point | 216.675°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Bromophenyl)-1,3-dihydro-2H-1,5-benzodiazepine-2-thione |