Online Database of Chemicals from Around the World
|
CAS#: 857531-01-2 Product: 4-(4-Bromophenyl)-4-(4-chlorophenyl)piperidine No suppilers available for the product. |
| Name | 4-(4-Bromophenyl)-4-(4-chlorophenyl)piperidine |
|---|---|
| Synonyms | 4-(4-Bromophenyl)-4-(4-chlorophenyl)piperidine; 4-(4-Bromophényl)-4-(4-chlorophényl)pipéridine; 4-(4-Bromphenyl)-4-(4-chlorphenyl)piperidin |
| Molecular Structure |  |
| Molecular Formula | C17H17BrClN |
| Molecular Weight | 350.68 |
| CAS Registry Number | 857531-01-2 |
| SMILES | c1cc(ccc1C2(CCNCC2)c3ccc(cc3)Br)Cl |
| InChI | 1S/C17H17BrClN/c18-15-5-1-13(2-6-15)17(9-11-20-12-10-17)14-3-7-16(19)8-4-14/h1-8,20H,9-12H2 |
| InChIKey | HMEHLWUVHGJFIM-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 207.6±28.7°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(4-Bromophenyl)-4-(4-chlorophenyl)piperidine |