| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 2-(Isopropylamino)-1-(3-methoxyphenyl)ethanone |
|---|---|
| Synonyms | 1-(3-methoxyphenyl)-2-[(methylethyl)amino]ethan-1-one; 2-Isopropylamino-1-(3-Methoxy-Phenyl)-Ethanone; 2-ISOPROPYLAMINO-3'-METHOXYACETOPHENONE |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| CAS Registry Number | 857724-35-7 |
| SMILES | CC(C)NCC(=O)C1=CC(=CC=C1)OC |
| InChI | 1S/C12H17NO2/c1-9(2)13-8-12(14)10-5-4-6-11(7-10)15-3/h4-7,9,13H,8H2,1-3H3 |
| InChIKey | CMVMLVASOJTAMI-UHFFFAOYSA-N |
| Density | 0.957-1.077 (Expl.) |
|---|---|
| 1.0±0.1g/cm3 (Cal.) | |
| Boiling point | 310.0±22.0°C at 760 mmHg (Cal.) |
| Flash point | 141.3±22.3°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(Isopropylamino)-1-(3-methoxyphenyl)ethanone |