|
CAS#: 85792-14-9 Product: 2-(4-Chloro-2-Methyl-Phenoxy)Propanoic Acid, Methyl 5-(2,4-Dichlorophe Noxy)-2-Nitro-Benzoate, N-Methylmethanamine No suppilers available for the product. |
| Name | 2-(4-Chloro-2-Methyl-Phenoxy)Propanoic Acid, Methyl 5-(2,4-Dichlorophe Noxy)-2-Nitro-Benzoate, N-Methylmethanamine |
|---|---|
| Synonyms | Bifox; Verigal |
| Molecular Structure | ![]() |
| Molecular Formula | C26H27Cl3N2O8 |
| Molecular Weight | 601.86 |
| CAS Registry Number | 85792-14-9 |
| SMILES | Clc2cc(Cl)ccc2Oc1cc(C(=O)OC)c([N+]([O-])=O)cc1.O=C(O)C(Oc1c(cc(Cl)cc1)C)C.N(C)C |
| InChI | 1S/C14H9Cl2NO5.C10H11ClO3.C2H7N/c1-21-14(18)10-7-9(3-4-12(10)17(19)20)22-13-5-2-8(15)6-11(13)16;1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-3-2/h2-7H,1H3;3-5,7H,1-2H3,(H,12,13);3H,1-2H3 |
| InChIKey | RNOTULNEVWPXCY-UHFFFAOYSA-N |
| Boiling point | 421°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 208.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chloro-2-Methyl-Phenoxy)Propanoic Acid, Methyl 5-(2,4-Dichlorophe Noxy)-2-Nitro-Benzoate, N-Methylmethanamine |