|
CAS#: 85807-50-7 Product: L-Alanylglycyl-L-serine No suppilers available for the product. |
| Name | L-Alanylglycyl-L-serine |
|---|---|
| Synonyms | AGS; A-G-S |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15N3O5 |
| Molecular Weight | 233.22 |
| CAS Registry Number | 85807-50-7 |
| SMILES | O=C(O)[C@@H](NC(=O)CNC(=O)[C@@H](N)C)CO |
| InChI | 1S/C8H15N3O5/c1-4(9)7(14)10-2-6(13)11-5(3-12)8(15)16/h4-5,12H,2-3,9H2,1H3,(H,10,14)(H,11,13)(H,15,16)/t4-,5-/m0/s1 |
| InChIKey | NBTGEURICRTMGL-WHFBIAKZSA-N |
| Density | 1.38g/cm3 (Cal.) |
|---|---|
| Boiling point | 660.249°C at 760 mmHg (Cal.) |
| Flash point | 353.106°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Alanylglycyl-L-serine |