|
CAS#: 85819-86-9 Product: 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) - 5-(4-chlorophenyl)-6-ethyl-2,4-pyrimidinediamine (1:1) No suppilers available for the product. |
| Name | 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) - 5-(4-chlorophenyl)-6-ethyl-2,4-pyrimidinediamine (1:1) |
|---|---|
| Synonyms | 2-Naphtha |
| Molecular Structure | ![]() |
| Molecular Formula | C35H29ClN4O6 |
| Molecular Weight | 637.08 |
| CAS Registry Number | 85819-86-9 |
| SMILES | O=C(O)c2cc1c(cccc1)c(c2O)Cc3c4c(cc(C(=O)O)c3O)cccc4.Clc2ccc(c1c(nc(nc1CC)N)N)cc2 |
| InChI | 1S/C23H16O6.C12H13ClN4/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h1-10,24-25H,11H2,(H,26,27)(H,28,29);3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | VJVWMYFEZGXNPC-UHFFFAOYSA-N |
| Boiling point | 642.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 356.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Methylenebis(3-hydroxy-2-naphthoic acid) - 5-(4-chlorophenyl)-6-ethyl-2,4-pyrimidinediamine (1:1) |