|
CAS#: 858454-17-8 Product: 4-(4-Morpholinyl)-2-phenylbutanoic acid hydrochloride (1:1) No suppilers available for the product. |
| Name | 4-(4-Morpholinyl)-2-phenylbutanoic acid hydrochloride (1:1) |
|---|---|
| Synonyms | 4-Morpholin-4-yl-2-phenyl-butyric acid hydrochloride; 4-MORPHOLIN-4-YL-2-PHENYL-BUTYRICACIDHCL |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 |
| CAS Registry Number | 858454-17-8 |
| SMILES | c1ccc(cc1)C(CCN2CCOCC2)C(=O)O.Cl |
| InChI | 1S/C14H19NO3.ClH/c16-14(17)13(12-4-2-1-3-5-12)6-7-15-8-10-18-11-9-15;/h1-5,13H,6-11H2,(H,16,17);1H |
| InChIKey | FWJKJOLNAMKLLR-UHFFFAOYSA-N |
| Refractive index | (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(4-Morpholinyl)-2-phenylbutanoic acid hydrochloride (1:1) |