|
CAS#: 85851-53-2 Product: 2-({5-Acetamido-4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-2-ethoxyphenyl}[2-(2-chloroacetoxy)ethyl]amino)ethyl butyrate No suppilers available for the product. |
| Name | 2-({5-Acetamido-4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-2-ethoxyphenyl}[2-(2-chloroacetoxy)ethyl]amino)ethyl butyrate |
|---|---|
| Synonyms | 2-[[5-(ac |
| Molecular Structure | ![]() |
| Molecular Formula | C26H30BrClN6O10 |
| Molecular Weight | 701.91 |
| CAS Registry Number | 85851-53-2 |
| EINECS | 288-613-1 |
| SMILES | Brc2cc(cc(c2N=Nc1cc(OCC)c(cc1NC(C)=O)N(CCOC(=O)CCC)CCOC(=O)CCl)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C26H30BrClN6O10/c1-4-6-24(36)43-9-7-32(8-10-44-25(37)15-28)21-13-19(29-16(3)35)20(14-23(21)42-5-2)30-31-26-18(27)11-17(33(38)39)12-22(26)34(40)41/h11-14H,4-10,15H2,1-3H3,(H,29,35) |
| InChIKey | JVKVLNPRPMQFPS-UHFFFAOYSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Boiling point | 840.931°C at 760 mmHg (Cal.) |
| Flash point | 462.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-({5-Acetamido-4-[(2-bromo-4,6-dinitrophenyl)diazenyl]-2-ethoxyphenyl}[2-(2-chloroacetoxy)ethyl]amino)ethyl butyrate |