|
CAS#: 85896-18-0 Product: Bis(2-hydroxyethanaminium) glutarate No suppilers available for the product. |
| Name | Bis(2-hydroxyethanaminium) glutarate |
|---|---|
| Synonyms | bis[(2-hydroxyethyl)ammonium] glutarate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H22N2O6 |
| Molecular Weight | 254.28 |
| CAS Registry Number | 85896-18-0 |
| EINECS | 288-795-2 |
| SMILES | O=C([O-])CCCC([O-])=O.[NH3+]CCO.[NH3+]CCO |
| InChI | 1S/C5H8O4.2C2H7NO/c6-4(7)2-1-3-5(8)9;2*3-1-2-4/h1-3H2,(H,6,7)(H,8,9);2*4H,1-3H2 |
| InChIKey | HXEQXXHIYGOZJP-UHFFFAOYSA-N |
| Boiling point | 575.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 302.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-hydroxyethanaminium) glutarate |