Online Database of Chemicals from Around the World
|
CAS#: 85915-86-2 Product: (2E)-3-({[2-(3,4-Dimethoxyphenyl)ethyl]amino}methyl)-4-[(2-hydroxybenzyl)oxy]-4-oxo-2-butenoic acid No suppilers available for the product. |
| Name | (2E)-3-({[2-(3,4-Dimethoxyphenyl)ethyl]amino}methyl)-4-[(2-hydroxybenzyl)oxy]-4-oxo-2-butenoic acid |
|---|---|
| Synonyms | TA 078; TA-078 |
| Molecular Structure | ![CAS#: 85915-86-2, (2E)-3-({[2-(3,4-Dimethoxyphenyl)ethyl]amino}methyl)-4-[(2-hydroxybenzyl)oxy]-4-oxo-2-butenoic acid](/moreStructures/85915-86-2.gif) |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 |
| CAS Registry Number | 85915-86-2 |
| SMILES | O=C(O)\C=C(\C(=O)OCc1ccccc1O)CNCCc2cc(OC)c(OC)cc2 |
| InChI | 1S/C22H25NO7/c1-28-19-8-7-15(11-20(19)29-2)9-10-23-13-17(12-21(25)26)22(27)30-14-16-5-3-4-6-18(16)24/h3-8,11-12,23-24H,9-10,13-14H2,1-2H3,(H,25,26)/b17-12+ |
| InChIKey | IGSWJKUKCNMFDT-SFQUDFHCSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.628°C at 760 mmHg (Cal.) |
| Flash point | 339.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-({[2-(3,4-Dimethoxyphenyl)ethyl]amino}methyl)-4-[(2-hydroxybenzyl)oxy]-4-oxo-2-butenoic acid |