|
CAS#: 85938-48-3 Product: Dibutyl(fluoro)phenylstannane No suppilers available for the product. |
| Name | Dibutyl(fluoro)phenylstannane |
|---|---|
| Synonyms | dibutylfluorophenylstannane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H23FSn |
| Molecular Weight | 329.04 |
| CAS Registry Number | 85938-48-3 |
| EINECS | 288-883-0 |
| SMILES | F[Sn](CCCC)(CCCC)c1ccccc1 |
| InChI | 1S/C6H5.2C4H9.FH.Sn/c1-2-4-6-5-3-1;2*1-3-4-2;;/h1-5H;2*1,3-4H2,2H3;1H;/q;;;;+1/p-1 |
| InChIKey | ZHYJTYYLZUPTRY-UHFFFAOYSA-M |
| Boiling point | 305.188°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 138.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibutyl(fluoro)phenylstannane |