Online Database of Chemicals from Around the World
|
CAS#: 85946-14-1 Product: 1-Amino-4-hydroxy-2-[2-(3-methylphenoxy)ethoxy]-9,10-anthraquinone No suppilers available for the product. |
| Name | 1-Amino-4-hydroxy-2-[2-(3-methylphenoxy)ethoxy]-9,10-anthraquinone |
|---|---|
| Synonyms | 1-amino-4-hydroxy-2-[2-(3-methylphenoxy)ethoxy]anthraquinone |
| Molecular Structure | ![CAS#: 85946-14-1, 1-Amino-4-hydroxy-2-[2-(3-methylphenoxy)ethoxy]-9,10-anthraquinone](/moreStructures/85946-14-1.gif) |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.40 |
| CAS Registry Number | 85946-14-1 |
| EINECS | 288-957-2 |
| SMILES | Cc1cc(ccc1)OCCOc4cc(O)c3c(C(=O)c2ccccc2C3=O)c4N |
| InChI | 1S/C23H19NO5/c1-13-5-4-6-14(11-13)28-9-10-29-18-12-17(25)19-20(21(18)24)23(27)16-8-3-2-7-15(16)22(19)26/h2-8,11-12,25H,9-10,24H2,1H3 |
| InChIKey | PRFLHIULISVRAU-UHFFFAOYSA-N |
| Density | 1.367g/cm3 (Cal.) |
|---|---|
| Boiling point | 666.864°C at 760 mmHg (Cal.) |
| Flash point | 357.106°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Amino-4-hydroxy-2-[2-(3-methylphenoxy)ethoxy]-9,10-anthraquinone |