|
CAS#: 85959-39-3 Product: Rubidium (2S)-5-oxo-2-pyrrolidinecarboxylate No suppilers available for the product. |
| Name | Rubidium (2S)-5-oxo-2-pyrrolidinecarboxylate |
|---|---|
| Synonyms | rubidium 5-oxo-DL-prolinate; rubidium 5-oxo-L-prolinate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H6NO3Rb |
| Molecular Weight | 213.57 |
| CAS Registry Number | 85959-39-3 |
| EINECS | 289-032-6 |
| SMILES | [Rb+].[O-]C(=O)[C@H]1NC(=O)CC1 |
| InChI | 1S/C5H7NO3.Rb/c7-4-2-1-3(6-4)5(8)9;/h3H,1-2H2,(H,6,7)(H,8,9);/q;+1/p-1/t3-;/m0./s1 |
| InChIKey | RGRBEEBQJAGAON-DFWYDOINSA-M |
| Boiling point | 453.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 227.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rubidium (2S)-5-oxo-2-pyrrolidinecarboxylate |