|
CAS#: 85975-26-4 Product: 3-(4-Biphenylyl)-N-(2-ethoxy-2-oxoethyl)-N-methyl-3-oxo-1-propanaminium chloride No suppilers available for the product. |
| Name | 3-(4-Biphenylyl)-N-(2-ethoxy-2-oxoethyl)-N-methyl-3-oxo-1-propanaminium chloride |
|---|---|
| Synonyms | GLYCINE, |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.86 |
| CAS Registry Number | 85975-26-4 |
| SMILES | [Cl-].O=C(OCC)C[NH+](C)CCC(=O)c2ccc(c1ccccc1)cc2 |
| InChI | 1S/C20H23NO3.ClH/c1-3-24-20(23)15-21(2)14-13-19(22)18-11-9-17(10-12-18)16-7-5-4-6-8-16;/h4-12H,3,13-15H2,1-2H3;1H |
| InChIKey | SZMIUTHKUFGAGE-UHFFFAOYSA-N |
| Boiling point | 467.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 236.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Biphenylyl)-N-(2-ethoxy-2-oxoethyl)-N-methyl-3-oxo-1-propanaminium chloride |