|
CAS#: 86047-14-5 Product: 10-Methyl-8H-benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione No suppilers available for the product. |
| Name | 10-Methyl-8H-benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione |
|---|---|
| Synonyms | NSC 377099 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H11N3O2 |
| Molecular Weight | 313.31 |
| CAS Registry Number | 86047-14-5 |
| SMILES | O=C/1c3nccc4c5ccccc5nc(C2=C/C(=O)N(C)/C=C\12)c34 |
| InChI | 1S/C19H11N3O2/c1-22-9-13-12(8-15(22)23)17-16-11(6-7-20-18(16)19(13)24)10-4-2-3-5-14(10)21-17/h2-9H,1H3 |
| InChIKey | GPJKOFLDDKEODA-UHFFFAOYSA-N |
| Density | 1.517g/cm3 (Cal.) |
|---|---|
| Boiling point | 644.334°C at 760 mmHg (Cal.) |
| Flash point | 343.481°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Methyl-8H-benzo[b]pyrido[4,3,2-de][1,8]phenanthroline-8,11(10H)-dione |