|
CAS#: 860683-32-5 Product: N-[(2Z)-4,5-Dimethyl-3-phenyl-1,3-thiazol-2(3H)-ylidene]benzamide No suppilers available for the product. |
| Name | N-[(2Z)-4,5-Dimethyl-3-phenyl-1,3-thiazol-2(3H)-ylidene]benzamide |
|---|---|
| Synonyms | N-(4,5-Dimethyl-3-phenyl-3H-thiazol-2-ylidene)-benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.40 |
| CAS Registry Number | 860683-32-5 |
| SMILES | Cc1c(s/c(=N\C(=O)c2ccccc2)/n1c3ccccc3)C |
| InChI | 1S/C18H16N2OS/c1-13-14(2)22-18(20(13)16-11-7-4-8-12-16)19-17(21)15-9-5-3-6-10-15/h3-12H,1-2H3/b19-18- |
| InChIKey | ONHLKLMXXHSCKG-HNENSFHCSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.204°C at 760 mmHg (Cal.) |
| Flash point | 227.285°C (Cal.) |
| Refractive index | 1.628 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2Z)-4,5-Dimethyl-3-phenyl-1,3-thiazol-2(3H)-ylidene]benzamide |