|
CAS#: 861033-75-2 Product: 4-(4-Methoxyphenyl)-2-phenyl-1H-pyrrole No suppilers available for the product. |
| Name | 4-(4-Methoxyphenyl)-2-phenyl-1H-pyrrole |
|---|---|
| Synonyms | 4-(4-Methoxy-phenyl)-2-phenyl-1H-pyrrole; 4-(P-METHOXYPHENYL)-2-PHENYLPYRROLE |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 |
| CAS Registry Number | 861033-75-2 |
| SMILES | O(c3ccc(c2cc(c1ccccc1)nc2)cc3)C |
| InChI | 1S/C17H15NO/c1-19-16-9-7-13(8-10-16)15-11-17(18-12-15)14-5-3-2-4-6-14/h2-12,18H,1H3 |
| InChIKey | KNKIAJCZNZNYJO-UHFFFAOYSA-N |
| Density | 1.121g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.109°C at 760 mmHg (Cal.) |
| Flash point | 160.919°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Methoxyphenyl)-2-phenyl-1H-pyrrole |