|
CAS#: 86126-37-6 Product: Diphenyl cyclooctylphosphoramidate No suppilers available for the product. |
| Name | Diphenyl cyclooctylphosphoramidate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H26NO3P |
| Molecular Weight | 359.40 |
| CAS Registry Number | 86126-37-6 |
| SMILES | O=P(Oc1ccccc1)(Oc2ccccc2)NC3CCCCCCC3 |
| InChI | 1S/C20H26NO3P/c22-25(23-19-14-8-4-9-15-19,24-20-16-10-5-11-17-20)21-18-12-6-2-1-3-7-13-18/h4-5,8-11,14-18H,1-3,6-7,12-13H2,(H,21,22) |
| InChIKey | BWATZXOKZTWXTQ-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.178°C at 760 mmHg (Cal.) |
| Flash point | 235.131°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenyl cyclooctylphosphoramidate |