|
CAS#: 86190-47-8 Product: N-{5-(sec-Butylamino)-2-[(2-chloro-4-nitrophenyl)diazenyl]phenyl}acetamide No suppilers available for the product. |
| Name | N-{5-(sec-Butylamino)-2-[(2-chloro-4-nitrophenyl)diazenyl]phenyl}acetamide |
|---|---|
| Synonyms | N-[2-[(2- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20ClN5O3 |
| Molecular Weight | 389.84 |
| CAS Registry Number | 86190-47-8 |
| EINECS | 289-203-5 |
| SMILES | Clc2cc(ccc2N=Nc1ccc(NC(C)CC)cc1NC(C)=O)[N+]([O-])=O |
| InChI | 1S/C18H20ClN5O3/c1-4-11(2)20-13-5-7-17(18(9-13)21-12(3)25)23-22-16-8-6-14(24(26)27)10-15(16)19/h5-11,20H,4H2,1-3H3,(H,21,25) |
| InChIKey | SLMDSOHNJYMVJP-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.712°C at 760 mmHg (Cal.) |
| Flash point | 335.848°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-{5-(sec-Butylamino)-2-[(2-chloro-4-nitrophenyl)diazenyl]phenyl}acetamide |